C18H16N4 — CID 157282596
3,5,6,7-tetramethylpyrazino[2,3-f][1,10]phenanthroline (PubChem CID 157282596) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3,5,6,7-tetramethylpyrazino[2,3-f][1,10]phenanthroline.
| Compound Name | 3,5,6,7-tetramethylpyrazino[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 157282596 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3,5,6,7-tetramethylpyrazino[2,3-f][1,10]phenanthroline |
| SMILES | Cc1cnc2c3cccnc3c3nc(C)c(C)c(C)c3c2n1 |
| InChI | InChI=1S/C18H16N4/c1-9-8-20-16-13-6-5-7-19-15(13)18-14(17(16)21-9)11(3)10(2)12(4)22-18/h5-8H,1-4H3 |
| InChIKey | NCKMBZCFOWESIJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|