C18H20N2 — CID 171384241
2,3,4,5,6,7-hexamethyl-1,8-phenanthroline (PubChem CID 171384241) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexamethyl-1,8-phenanthroline.
| Compound Name | 2,3,4,5,6,7-hexamethyl-1,8-phenanthroline |
|---|---|
| PubChem CID | 171384241 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2,3,4,5,6,7-hexamethyl-1,8-phenanthroline |
| SMILES | Cc1nc2c(c(C)c1C)c(C)c(C)c1c(C)nccc12 |
| InChI | InChI=1S/C18H20N2/c1-9-10(2)16-11(3)12(4)17-14(6)19-8-7-15(17)18(16)20-13(9)5/h7-8H,1-6H3 |
| InChIKey | BQIODHMXEPHLDO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|