C14H10N6 — CID 165049809
4,10-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene (PubChem CID 165049809) has the molecular formula C14H10N6 and a molecular weight of 262.28 g/mol. Its IUPAC name is 4,10-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene.
| Compound Name | 4,10-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 165049809 |
| Molecular Formula | C14H10N6 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4,10-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene |
| SMILES | Cc1cnc2c3nccnc3c3nc(C)cnc3c2n1 |
| InChI | InChI=1S/C14H10N6/c1-7-5-17-11-9-10(16-4-3-15-9)13-12(14(11)20-7)18-6-8(2)19-13/h3-6H,1-2H3 |
| InChIKey | PCEWAVGONBAUSU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|