C9H6N6 — CID 157282593
5-methyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 157282593) has the molecular formula C9H6N6 and a molecular weight of 198.19 g/mol. Its IUPAC name is 5-methyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | 5-methyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 157282593 |
| Molecular Formula | C9H6N6 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 5-methyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | Cc1cnc2nc3nccnc3nc2n1 |
| InChI | InChI=1S/C9H6N6/c1-5-4-12-8-9(13-5)15-7-6(14-8)10-2-3-11-7/h2-4H,1H3 |
| InChIKey | JDIJXXNFYAAEQI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|