C8H6BrN3 — CID 84688958
7-bromo-3-methylpyrido[2,3-b]pyrazine (PubChem CID 84688958) has the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. Its IUPAC name is 7-bromo-3-methylpyrido[2,3-b]pyrazine.
| Compound Name | 7-bromo-3-methylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 84688958 |
| Molecular Formula | C8H6BrN3 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 7-bromo-3-methylpyrido[2,3-b]pyrazine |
| SMILES | Cc1cnc2cc(Br)cnc2n1 |
| InChI | InChI=1S/C8H6BrN3/c1-5-3-10-7-2-6(9)4-11-8(7)12-5/h2-4H,1H3 |
| InChIKey | KGSSRHCEUSIBQL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |