C8H5Br2N3 — CID 133055440
2,6-dibromo-4-methylpyrido[2,3-d]pyrimidine (PubChem CID 133055440) has the molecular formula C8H5Br2N3 and a molecular weight of 302.96 g/mol. Its IUPAC name is 2,6-dibromo-4-methylpyrido[2,3-d]pyrimidine.
| Compound Name | 2,6-dibromo-4-methylpyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133055440 |
| Molecular Formula | C8H5Br2N3 |
| Molecular Weight | 302.96 g/mol |
| Exact Mass | 300.89 |
| IUPAC Name | 2,6-dibromo-4-methylpyrido[2,3-d]pyrimidine |
| SMILES | Cc1nc(Br)nc2ncc(Br)cc12 |
| InChI | InChI=1S/C8H5Br2N3/c1-4-6-2-5(9)3-11-7(6)13-8(10)12-4/h2-3H,1H3 |
| InChIKey | GDTFPYKJUPEODH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.96 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |