C12H19BrN2 — CID 145223715
5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;ethane (PubChem CID 145223715) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;ethane.
| Compound Name | 5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;ethane |
|---|---|
| PubChem CID | 145223715 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;ethane |
| SMILES | CC.CC.Cc1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C8H7BrN2.2C2H6/c1-5-3-10-8-7(5)2-6(9)4-11-8;2*1-2/h2-4H,1H3,(H,10,11);2*1-2H3 |
| InChIKey | WWALXJPHSOYVDM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |