C11H11BrN4 — CID 143178872
N-[(Z)-[(E)-3-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enylidene]amino]methanamine (PubChem CID 143178872) has the molecular formula C11H11BrN4 and a molecular weight of 279.14 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enylidene]amino]methanamine.
| Compound Name | N-[(Z)-[(E)-3-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enylidene]amino]methanamine |
|---|---|
| PubChem CID | 143178872 |
| Molecular Formula | C11H11BrN4 |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | N-[(Z)-[(E)-3-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enylidene]amino]methanamine |
| SMILES | CN/N=C\C=C\c1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C11H11BrN4/c1-13-16-4-2-3-8-6-14-11-10(8)5-9(12)7-15-11/h2-7,13H,1H3,(H,14,15)/b3-2+,16-4- |
| InChIKey | UJJURZXJQFPKIW-CYTILCLQSA-N |
| XLogP | 2.54 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|