About (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone
(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone (PubChem CID 58086013) has the molecular formula C14H7BrCl2N2O
and a molecular weight of 370.03 g/mol. Its IUPAC name is (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone.
Molecular Properties
| Compound Name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone |
| PubChem CID | 58086013 |
| Molecular Formula | C14H7BrCl2N2O |
| Molecular Weight | 370.03 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)c1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C14H7BrCl2N2O/c15-8-3-11-12(6-19-14(11)18-5-8)13(20)7-1-9(16)4-10(17)2-7/h1-6H,(H,18,19) |
| InChIKey | SCNBKRJLHGXLQZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.03 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone?
The IUPAC name of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone (CID 58086013) is (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone.
What is the SMILES notation for (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone?
The canonical SMILES for (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone is O=C(c1cc(Cl)cc(Cl)c1)c1c[nH]c2ncc(Br)cc12.
What is the InChIKey of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone?
The InChIKey is SCNBKRJLHGXLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrCl2N2O/c15-8-3-11-12(6-19-14(11)18-5-8)13(20)7-1-9(16)4-10(17)2-7/h1-6H,(H,18,19).
What are the key properties of (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone?
(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone has a molecular weight of 370.03 g/mol, XLogP of 4.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-dichlorophenyl)methanone is sourced from PubChem (CID 58086013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).