C14H9BrClN3O — CID 106884994
(2-amino-3-chlorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 106884994) has the molecular formula C14H9BrClN3O and a molecular weight of 350.60 g/mol. Its IUPAC name is (2-amino-3-chlorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (2-amino-3-chlorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 106884994 |
| Molecular Formula | C14H9BrClN3O |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | (2-amino-3-chlorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | Nc1c(Cl)cccc1C(=O)c1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C14H9BrClN3O/c15-7-4-9-10(6-19-14(9)18-5-7)13(20)8-2-1-3-11(16)12(8)17/h1-6H,17H2,(H,18,19) |
| InChIKey | RILFAQWPDLQTQJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|