C7H6N3P — CID 144598202
pyrido[2,3-b]pyrazin-7-ylphosphane (PubChem CID 144598202) has the molecular formula C7H6N3P and a molecular weight of 163.12 g/mol. Its IUPAC name is pyrido[2,3-b]pyrazin-7-ylphosphane.
| Compound Name | pyrido[2,3-b]pyrazin-7-ylphosphane |
|---|---|
| PubChem CID | 144598202 |
| Molecular Formula | C7H6N3P |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | pyrido[2,3-b]pyrazin-7-ylphosphane |
| SMILES | Pc1cnc2nccnc2c1 |
| InChI | InChI=1S/C7H6N3P/c11-5-3-6-7(10-4-5)9-2-1-8-6/h1-4H,11H2 |
| InChIKey | BXIGTORKDZQTSW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|