About 2-pteridin-2-ylpteridine
2-pteridin-2-ylpteridine (PubChem CID 90758261) has the molecular formula C12H6N8
and a molecular weight of 262.24 g/mol. Its IUPAC name is 2-pteridin-2-ylpteridine.
Molecular Properties
| Compound Name | 2-pteridin-2-ylpteridine |
| PubChem CID | 90758261 |
| Molecular Formula | C12H6N8 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-pteridin-2-ylpteridine |
| SMILES | c1cnc2nc(-c3ncc4nccnc4n3)ncc2n1 |
| InChI | InChI=1S/C12H6N8/c1-3-15-9-7(13-1)5-17-11(19-9)12-18-6-8-10(20-12)16-4-2-14-8/h1-6H |
| InChIKey | BTSOLWXOTMALFV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-pteridin-2-ylpteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pteridin-2-ylpteridine?
The IUPAC name of 2-pteridin-2-ylpteridine (CID 90758261) is 2-pteridin-2-ylpteridine.
What is the SMILES notation for 2-pteridin-2-ylpteridine?
The canonical SMILES for 2-pteridin-2-ylpteridine is c1cnc2nc(-c3ncc4nccnc4n3)ncc2n1.
What is the InChIKey of 2-pteridin-2-ylpteridine?
The InChIKey is BTSOLWXOTMALFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N8/c1-3-15-9-7(13-1)5-17-11(19-9)12-18-6-8-10(20-12)16-4-2-14-8/h1-6H.
What are the key properties of 2-pteridin-2-ylpteridine?
2-pteridin-2-ylpteridine has a molecular weight of 262.24 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pteridin-2-ylpteridine is sourced from PubChem (CID 90758261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).