About pyrazino[2,3-b]quinoline
pyrazino[2,3-b]quinoline (PubChem CID 70431198) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is pyrazino[2,3-b]quinoline.
Molecular Properties
| Compound Name | pyrazino[2,3-b]quinoline |
| PubChem CID | 70431198 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | pyrazino[2,3-b]quinoline |
| SMILES | c1ccc2nc3nccnc3cc2c1 |
| InChI | InChI=1S/C11H7N3/c1-2-4-9-8(3-1)7-10-11(14-9)13-6-5-12-10/h1-7H |
| InChIKey | DOYZUIVFHBHIPX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze pyrazino[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazino[2,3-b]quinoline?
The IUPAC name of pyrazino[2,3-b]quinoline (CID 70431198) is pyrazino[2,3-b]quinoline.
What is the SMILES notation for pyrazino[2,3-b]quinoline?
The canonical SMILES for pyrazino[2,3-b]quinoline is c1ccc2nc3nccnc3cc2c1.
What is the InChIKey of pyrazino[2,3-b]quinoline?
The InChIKey is DOYZUIVFHBHIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3/c1-2-4-9-8(3-1)7-10-11(14-9)13-6-5-12-10/h1-7H.
What are the key properties of pyrazino[2,3-b]quinoline?
pyrazino[2,3-b]quinoline has a molecular weight of 181.20 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazino[2,3-b]quinoline is sourced from PubChem (CID 70431198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).