About iron;quinoxaline
iron;quinoxaline (PubChem CID 161047921) has the molecular formula C8H6FeN2
and a molecular weight of 186.00 g/mol. Its IUPAC name is iron;quinoxaline.
Molecular Properties
| Compound Name | iron;quinoxaline |
| PubChem CID | 161047921 |
| Molecular Formula | C8H6FeN2 |
| Molecular Weight | 186.00 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | iron;quinoxaline |
| SMILES | [Fe].c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2.Fe/c1-2-4-8-7(3-1)9-5-6-10-8;/h1-6H; |
| InChIKey | UBSZSISYPQSAEO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.00 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;quinoxaline?
The IUPAC name of iron;quinoxaline (CID 161047921) is iron;quinoxaline.
What is the SMILES notation for iron;quinoxaline?
The canonical SMILES for iron;quinoxaline is [Fe].c1ccc2nccnc2c1.
What is the InChIKey of iron;quinoxaline?
The InChIKey is UBSZSISYPQSAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.Fe/c1-2-4-8-7(3-1)9-5-6-10-8;/h1-6H;.
What are the key properties of iron;quinoxaline?
iron;quinoxaline has a molecular weight of 186.00 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron;quinoxaline is sourced from PubChem (CID 161047921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).