About aniline;quinoxaline
aniline;quinoxaline (PubChem CID 70629272) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is aniline;quinoxaline.
Molecular Properties
| Compound Name | aniline;quinoxaline |
| PubChem CID | 70629272 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | aniline;quinoxaline |
| SMILES | Nc1ccccc1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2.C6H7N/c1-2-4-8-7(3-1)9-5-6-10-8;7-6-4-2-1-3-5-6/h1-6H;1-5H,7H2 |
| InChIKey | GNMSMZBWGBUGFE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;quinoxaline?
The IUPAC name of aniline;quinoxaline (CID 70629272) is aniline;quinoxaline.
What is the SMILES notation for aniline;quinoxaline?
The canonical SMILES for aniline;quinoxaline is Nc1ccccc1.c1ccc2nccnc2c1.
What is the InChIKey of aniline;quinoxaline?
The InChIKey is GNMSMZBWGBUGFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C6H7N/c1-2-4-8-7(3-1)9-5-6-10-8;7-6-4-2-1-3-5-6/h1-6H;1-5H,7H2.
What are the key properties of aniline;quinoxaline?
aniline;quinoxaline has a molecular weight of 223.28 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;quinoxaline is sourced from PubChem (CID 70629272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).