About phenol;quinoxaline;hydrate
phenol;quinoxaline;hydrate (PubChem CID 174252210) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is phenol;quinoxaline;hydrate.
Molecular Properties
| Compound Name | phenol;quinoxaline;hydrate |
| PubChem CID | 174252210 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | phenol;quinoxaline;hydrate |
| SMILES | O.Oc1ccccc1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2.C6H6O.H2O/c1-2-4-8-7(3-1)9-5-6-10-8;7-6-4-2-1-3-5-6;/h1-6H;1-5,7H;1H2 |
| InChIKey | OMXFFDXSROTFMX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenol;quinoxaline;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;quinoxaline;hydrate?
The IUPAC name of phenol;quinoxaline;hydrate (CID 174252210) is phenol;quinoxaline;hydrate.
What is the SMILES notation for phenol;quinoxaline;hydrate?
The canonical SMILES for phenol;quinoxaline;hydrate is O.Oc1ccccc1.c1ccc2nccnc2c1.
What is the InChIKey of phenol;quinoxaline;hydrate?
The InChIKey is OMXFFDXSROTFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C6H6O.H2O/c1-2-4-8-7(3-1)9-5-6-10-8;7-6-4-2-1-3-5-6;/h1-6H;1-5,7H;1H2.
What are the key properties of phenol;quinoxaline;hydrate?
phenol;quinoxaline;hydrate has a molecular weight of 242.28 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;quinoxaline;hydrate is sourced from PubChem (CID 174252210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).