About bis(5-methylbenzene-1,3-diol);quinoxaline
bis(5-methylbenzene-1,3-diol);quinoxaline (PubChem CID 139147357) has the molecular formula C22H22N2O4
and a molecular weight of 378.43 g/mol. Its IUPAC name is bis(5-methylbenzene-1,3-diol);quinoxaline.
Molecular Properties
| Compound Name | bis(5-methylbenzene-1,3-diol);quinoxaline |
| PubChem CID | 139147357 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | bis(5-methylbenzene-1,3-diol);quinoxaline |
| SMILES | Cc1cc(O)cc(O)c1.Cc1cc(O)cc(O)c1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2.2C7H8O2/c1-2-4-8-7(3-1)9-5-6-10-8;2*1-5-2-6(8)4-7(9)3-5/h1-6H;2*2-4,8-9H,1H3 |
| InChIKey | RAYJDTYJCPRUEY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(5-methylbenzene-1,3-diol);quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-methylbenzene-1,3-diol);quinoxaline?
The IUPAC name of bis(5-methylbenzene-1,3-diol);quinoxaline (CID 139147357) is bis(5-methylbenzene-1,3-diol);quinoxaline.
What is the SMILES notation for bis(5-methylbenzene-1,3-diol);quinoxaline?
The canonical SMILES for bis(5-methylbenzene-1,3-diol);quinoxaline is Cc1cc(O)cc(O)c1.Cc1cc(O)cc(O)c1.c1ccc2nccnc2c1.
What is the InChIKey of bis(5-methylbenzene-1,3-diol);quinoxaline?
The InChIKey is RAYJDTYJCPRUEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.2C7H8O2/c1-2-4-8-7(3-1)9-5-6-10-8;2*1-5-2-6(8)4-7(9)3-5/h1-6H;2*2-4,8-9H,1H3.
What are the key properties of bis(5-methylbenzene-1,3-diol);quinoxaline?
bis(5-methylbenzene-1,3-diol);quinoxaline has a molecular weight of 378.43 g/mol, XLogP of 4.44, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-methylbenzene-1,3-diol);quinoxaline is sourced from PubChem (CID 139147357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).