C10H16O2 — CID 70587781
5-methylbenzene-1,3-diol;propane (PubChem CID 70587781) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-methylbenzene-1,3-diol;propane.
| Compound Name | 5-methylbenzene-1,3-diol;propane |
|---|---|
| PubChem CID | 70587781 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 5-methylbenzene-1,3-diol;propane |
| SMILES | CCC.Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C7H8O2.C3H8/c1-5-2-6(8)4-7(9)3-5;1-3-2/h2-4,8-9H,1H3;3H2,1-2H3 |
| InChIKey | JVWCFNCDYCRYEI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |