About carbanide;3,5-dimethylphenol;titanium(2+)
carbanide;3,5-dimethylphenol;titanium(2+) (PubChem CID 174659955) has the molecular formula C10H16OTi
and a molecular weight of 200.10 g/mol. Its IUPAC name is carbanide;3,5-dimethylphenol;titanium(2+).
Molecular Properties
| Compound Name | carbanide;3,5-dimethylphenol;titanium(2+) |
| PubChem CID | 174659955 |
| Molecular Formula | C10H16OTi |
| Molecular Weight | 200.10 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | carbanide;3,5-dimethylphenol;titanium(2+) |
| SMILES | Cc1cc(C)cc(O)c1.[CH3-].[CH3-].[Ti+2] |
| InChI | InChI=1S/C8H10O.2CH3.Ti/c1-6-3-7(2)5-8(9)4-6;;;/h3-5,9H,1-2H3;2*1H3;/q;2*-1;+2 |
| InChIKey | IFOJEYPAUASRHO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3,5-dimethylphenol;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3,5-dimethylphenol;titanium(2+)?
The IUPAC name of carbanide;3,5-dimethylphenol;titanium(2+) (CID 174659955) is carbanide;3,5-dimethylphenol;titanium(2+).
What is the SMILES notation for carbanide;3,5-dimethylphenol;titanium(2+)?
The canonical SMILES for carbanide;3,5-dimethylphenol;titanium(2+) is Cc1cc(C)cc(O)c1.[CH3-].[CH3-].[Ti+2].
What is the InChIKey of carbanide;3,5-dimethylphenol;titanium(2+)?
The InChIKey is IFOJEYPAUASRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.2CH3.Ti/c1-6-3-7(2)5-8(9)4-6;;;/h3-5,9H,1-2H3;2*1H3;/q;2*-1;+2.
What are the key properties of carbanide;3,5-dimethylphenol;titanium(2+)?
carbanide;3,5-dimethylphenol;titanium(2+) has a molecular weight of 200.10 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3,5-dimethylphenol;titanium(2+) is sourced from PubChem (CID 174659955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).