About furan;quinoxaline
furan;quinoxaline (PubChem CID 163781594) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is furan;quinoxaline.
Molecular Properties
| Compound Name | furan;quinoxaline |
| PubChem CID | 163781594 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | furan;quinoxaline |
| SMILES | c1ccc2nccnc2c1.c1ccoc1 |
| InChI | InChI=1S/C8H6N2.C4H4O/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-4-5-3-1/h1-6H;1-4H |
| InChIKey | MPAVQROJSLVMQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan;quinoxaline?
The IUPAC name of furan;quinoxaline (CID 163781594) is furan;quinoxaline.
What is the SMILES notation for furan;quinoxaline?
The canonical SMILES for furan;quinoxaline is c1ccc2nccnc2c1.c1ccoc1.
What is the InChIKey of furan;quinoxaline?
The InChIKey is MPAVQROJSLVMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C4H4O/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-4-5-3-1/h1-6H;1-4H.
What are the key properties of furan;quinoxaline?
furan;quinoxaline has a molecular weight of 198.22 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan;quinoxaline is sourced from PubChem (CID 163781594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).