About copper(1+);quinoxaline;2H-thiophen-2-ide
copper(1+);quinoxaline;2H-thiophen-2-ide (PubChem CID 130176708) has the molecular formula C12H9CuN2S
and a molecular weight of 276.83 g/mol. Its IUPAC name is copper(1+);quinoxaline;2H-thiophen-2-ide.
Molecular Properties
| Compound Name | copper(1+);quinoxaline;2H-thiophen-2-ide |
| PubChem CID | 130176708 |
| Molecular Formula | C12H9CuN2S |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | copper(1+);quinoxaline;2H-thiophen-2-ide |
| SMILES | [Cu+].[c-]1cccs1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2.C4H3S.Cu/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-4-5-3-1;/h1-6H;1-3H;/q;-1;+1 |
| InChIKey | AHITVIZIULHLKE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);quinoxaline;2H-thiophen-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);quinoxaline;2H-thiophen-2-ide?
The IUPAC name of copper(1+);quinoxaline;2H-thiophen-2-ide (CID 130176708) is copper(1+);quinoxaline;2H-thiophen-2-ide.
What is the SMILES notation for copper(1+);quinoxaline;2H-thiophen-2-ide?
The canonical SMILES for copper(1+);quinoxaline;2H-thiophen-2-ide is [Cu+].[c-]1cccs1.c1ccc2nccnc2c1.
What is the InChIKey of copper(1+);quinoxaline;2H-thiophen-2-ide?
The InChIKey is AHITVIZIULHLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C4H3S.Cu/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-4-5-3-1;/h1-6H;1-3H;/q;-1;+1.
What are the key properties of copper(1+);quinoxaline;2H-thiophen-2-ide?
copper(1+);quinoxaline;2H-thiophen-2-ide has a molecular weight of 276.83 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);quinoxaline;2H-thiophen-2-ide is sourced from PubChem (CID 130176708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).