About 4-chloroquinoline;ethane
4-chloroquinoline;ethane (PubChem CID 91461667) has the molecular formula C11H12ClN
and a molecular weight of 193.68 g/mol. Its IUPAC name is 4-chloroquinoline;ethane.
Molecular Properties
| Compound Name | 4-chloroquinoline;ethane |
| PubChem CID | 91461667 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-chloroquinoline;ethane |
| SMILES | CC.Clc1ccnc2ccccc12 |
| InChI | InChI=1S/C9H6ClN.C2H6/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2/h1-6H;1-2H3 |
| InChIKey | KHFBOKXZMDTTBV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloroquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroquinoline;ethane?
The IUPAC name of 4-chloroquinoline;ethane (CID 91461667) is 4-chloroquinoline;ethane.
What is the SMILES notation for 4-chloroquinoline;ethane?
The canonical SMILES for 4-chloroquinoline;ethane is CC.Clc1ccnc2ccccc12.
What is the InChIKey of 4-chloroquinoline;ethane?
The InChIKey is KHFBOKXZMDTTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN.C2H6/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2/h1-6H;1-2H3.
What are the key properties of 4-chloroquinoline;ethane?
4-chloroquinoline;ethane has a molecular weight of 193.68 g/mol, XLogP of 3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroquinoline;ethane is sourced from PubChem (CID 91461667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).