About argon;4-methylquinoline
argon;4-methylquinoline (PubChem CID 175059803) has the molecular formula C10H9ArN
and a molecular weight of 183.14 g/mol. Its IUPAC name is argon;4-methylquinoline.
Molecular Properties
| Compound Name | argon;4-methylquinoline |
| PubChem CID | 175059803 |
| Molecular Formula | C10H9ArN |
| Molecular Weight | 183.14 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | argon;4-methylquinoline |
| SMILES | Cc1ccnc2ccccc12.[Ar] |
| InChI | InChI=1S/C10H9N.Ar/c1-8-6-7-11-10-5-3-2-4-9(8)10;/h2-7H,1H3; |
| InChIKey | BUDKLEDHBNRHBF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze argon;4-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;4-methylquinoline?
The IUPAC name of argon;4-methylquinoline (CID 175059803) is argon;4-methylquinoline.
What is the SMILES notation for argon;4-methylquinoline?
The canonical SMILES for argon;4-methylquinoline is Cc1ccnc2ccccc12.[Ar].
What is the InChIKey of argon;4-methylquinoline?
The InChIKey is BUDKLEDHBNRHBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.Ar/c1-8-6-7-11-10-5-3-2-4-9(8)10;/h2-7H,1H3;.
What are the key properties of argon;4-methylquinoline?
argon;4-methylquinoline has a molecular weight of 183.14 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for argon;4-methylquinoline is sourced from PubChem (CID 175059803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).