C9H5Cl2N — CID 6866
4,7-dichloroquinoline (PubChem CID 6866) has the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. Its IUPAC name is 4,7-dichloroquinoline.
| Compound Name | 4,7-dichloroquinoline |
|---|---|
| PubChem CID | 6866 |
| Molecular Formula | C9H5Cl2N |
| Molecular Weight | 198.05 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 4,7-dichloroquinoline |
| SMILES | Clc1ccc2c(Cl)ccnc2c1 |
| InChI | InChI=1S/C9H5Cl2N/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H |
| InChIKey | HXEWMTXDBOQQKO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.05 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |