C12H11ClN2O — CID 67304635
4-chloro-N,N-dimethylquinoline-7-carboxamide (PubChem CID 67304635) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 4-chloro-N,N-dimethylquinoline-7-carboxamide.
| Compound Name | 4-chloro-N,N-dimethylquinoline-7-carboxamide |
|---|---|
| PubChem CID | 67304635 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-chloro-N,N-dimethylquinoline-7-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(Cl)ccnc2c1 |
| InChI | InChI=1S/C12H11ClN2O/c1-15(2)12(16)8-3-4-9-10(13)5-6-14-11(9)7-8/h3-7H,1-2H3 |
| InChIKey | OHLZWFPXBCKSOK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |