C8H12N4O — CID 62236400
2-hydrazinyl-N,N-dimethylpyridine-4-carboxamide (PubChem CID 62236400) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-dimethylpyridine-4-carboxamide.
| Compound Name | 2-hydrazinyl-N,N-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 62236400 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-hydrazinyl-N,N-dimethylpyridine-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccnc(NN)c1 |
| InChI | InChI=1S/C8H12N4O/c1-12(2)8(13)6-3-4-10-7(5-6)11-9/h3-5H,9H2,1-2H3,(H,10,11) |
| InChIKey | IURFVXPZAZDUSU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|