2-hydrazinylpyridine-4-carboxylic acid

C6H7N3O2 — CID 26967246

IUPAC2-hydrazinylpyridine-4-carboxylic acid
SMILESNNc1cc(C(=O)O)ccn1
InChIInChI=1S/C6H7N3O2/c7-9-5-3-4(6(10)11)1-2-8-5/h1-3H,7H2,(H,8,9)(H,10,11)
InChIKeyPWRFHRBNLUGPHN-UHFFFAOYSA-N
MW153.14 g/mol
LogP0.07
Rot. Bonds2

About 2-hydrazinylpyridine-4-carboxylic acid

2-hydrazinylpyridine-4-carboxylic acid (PubChem CID 26967246) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is 2-hydrazinylpyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-hydrazinylpyridine-4-carboxylic acid
PubChem CID26967246
Molecular FormulaC6H7N3O2
Molecular Weight153.14 g/mol
Exact Mass153.05
IUPAC Name2-hydrazinylpyridine-4-carboxylic acid
SMILESNNc1cc(C(=O)O)ccn1
InChIInChI=1S/C6H7N3O2/c7-9-5-3-4(6(10)11)1-2-8-5/h1-3H,7H2,(H,8,9)(H,10,11)
InChIKeyPWRFHRBNLUGPHN-UHFFFAOYSA-N
XLogP0.07
TPSA88.24 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.14
LogP ≤ 50.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hydrazinylpyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydrazinylpyridine-4-carboxylic acid?
The IUPAC name of 2-hydrazinylpyridine-4-carboxylic acid (CID 26967246) is 2-hydrazinylpyridine-4-carboxylic acid.
What is the SMILES notation for 2-hydrazinylpyridine-4-carboxylic acid?
The canonical SMILES for 2-hydrazinylpyridine-4-carboxylic acid is NNc1cc(C(=O)O)ccn1.
What is the InChIKey of 2-hydrazinylpyridine-4-carboxylic acid?
The InChIKey is PWRFHRBNLUGPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c7-9-5-3-4(6(10)11)1-2-8-5/h1-3H,7H2,(H,8,9)(H,10,11).
What are the key properties of 2-hydrazinylpyridine-4-carboxylic acid?
2-hydrazinylpyridine-4-carboxylic acid has a molecular weight of 153.14 g/mol, XLogP of 0.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinylpyridine-4-carboxylic acid is sourced from PubChem (CID 26967246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).