C12H7F3N2O2 — CID 62815223
2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid (PubChem CID 62815223) has the molecular formula C12H7F3N2O2 and a molecular weight of 268.19 g/mol. Its IUPAC name is 2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid.
| Compound Name | 2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 62815223 |
| Molecular Formula | C12H7F3N2O2 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(Nc2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C12H7F3N2O2/c13-7-4-9(15)10(5-8(7)14)17-11-3-6(12(18)19)1-2-16-11/h1-5H,(H,16,17)(H,18,19) |
| InChIKey | UBEKBPGSXCDHMA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|