C12H6ClF3N2O2 — CID 114919577
5-chloro-2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid (PubChem CID 114919577) has the molecular formula C12H6ClF3N2O2 and a molecular weight of 302.64 g/mol. Its IUPAC name is 5-chloro-2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919577 |
| Molecular Formula | C12H6ClF3N2O2 |
| Molecular Weight | 302.64 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5-chloro-2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Nc2cc(F)c(F)cc2F)ncc1Cl |
| InChI | InChI=1S/C12H6ClF3N2O2/c13-6-4-17-11(1-5(6)12(19)20)18-10-3-8(15)7(14)2-9(10)16/h1-4H,(H,17,18)(H,19,20) |
| InChIKey | YUBFKYIDCXUASX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|