2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid

C16H12N2O2 — CID 60726061

IUPAC2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid
SMILESO=C(O)c1ccnc(Nc2ccc3ccccc3c2)c1
InChIInChI=1S/C16H12N2O2/c19-16(20)13-7-8-17-15(10-13)18-14-6-5-11-3-1-2-4-12(11)9-14/h1-10H,(H,17,18)(H,19,20)
InChIKeyVCNUKSXPWYVBBO-UHFFFAOYSA-N
MW264.28 g/mol
LogP3.68
Rot. Bonds3

About 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid

2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid (PubChem CID 60726061) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid
PubChem CID60726061
Molecular FormulaC16H12N2O2
Molecular Weight264.28 g/mol
Exact Mass264.09
IUPAC Name2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid
SMILESO=C(O)c1ccnc(Nc2ccc3ccccc3c2)c1
InChIInChI=1S/C16H12N2O2/c19-16(20)13-7-8-17-15(10-13)18-14-6-5-11-3-1-2-4-12(11)9-14/h1-10H,(H,17,18)(H,19,20)
InChIKeyVCNUKSXPWYVBBO-UHFFFAOYSA-N
XLogP3.68
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 53.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(6-bromonaphthalen-2-yl)amino]pyridine-4-carboxylic acid
CID 81266781
2-(3,4-dichloroanilino)pyridine-4-carboxylic acid
CID 13082139
2-hydrazinyl-N-naphthalen-2-ylpyridine-4-carboxamide
CID 62248189
2-(quinolin-6-ylamino)pyridine-4-carboxamide
CID 117094623
2-[4-bromo-3-(trifluoromethyl)anilino]pyridine-4-carboxylic acid
CID 64855140
2-(4-butylanilino)pyridine-4-carboxylic acid
CID 43244051
naphthalene-2-carboxylic acid
CID 175967775
2-hydrazinylpyridine-4-carboxylic acid
CID 26967246
6-[[6-(3-carboxyanilino)-2-[(6-carboxynaphthalen-2-yl)amino]pyrimidin-4-yl]amino]naphthalene-2-carboxylic acid
CID 58716209
naphthalene-2-carboxylic acid;dihydrochloride
CID 70357946
2-(2,4,5-trifluoroanilino)pyridine-4-carboxylic acid
CID 62815223
1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-methoxyphenyl)urea
CID 67062321

Frequently Asked Questions

What is the IUPAC name of 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid?
The IUPAC name of 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid (CID 60726061) is 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid?
The canonical SMILES for 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid is O=C(O)c1ccnc(Nc2ccc3ccccc3c2)c1.
What is the InChIKey of 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid?
The InChIKey is VCNUKSXPWYVBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2/c19-16(20)13-7-8-17-15(10-13)18-14-6-5-11-3-1-2-4-12(11)9-14/h1-10H,(H,17,18)(H,19,20).
What are the key properties of 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid?
2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid has a molecular weight of 264.28 g/mol, XLogP of 3.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(naphthalen-2-ylamino)pyridine-4-carboxylic acid is sourced from PubChem (CID 60726061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).