C24H21N5O2 — CID 67062321
1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-methoxyphenyl)urea (PubChem CID 67062321) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 67062321 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cc(-c3ccnc(Nc4ccccc4)c3)ccn2)cc1 |
| InChI | InChI=1S/C24H21N5O2/c1-31-21-9-7-20(8-10-21)28-24(30)29-23-16-18(12-14-26-23)17-11-13-25-22(15-17)27-19-5-3-2-4-6-19/h2-16H,1H3,(H,25,27)(H2,26,28,29,30) |
| InChIKey | CRVQUSCTBGBYTD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |