C23H18N6O3 — CID 67062216
1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-nitrophenyl)urea (PubChem CID 67062216) has the molecular formula C23H18N6O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 67062216 |
| Molecular Formula | C23H18N6O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-[4-(2-anilino-4-pyridinyl)-2-pyridinyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1cc(-c2ccnc(Nc3ccccc3)c2)ccn1 |
| InChI | InChI=1S/C23H18N6O3/c30-23(27-19-6-8-20(9-7-19)29(31)32)28-22-15-17(11-13-25-22)16-10-12-24-21(14-16)26-18-4-2-1-3-5-18/h1-15H,(H,24,26)(H2,25,27,28,30) |
| InChIKey | MCMDRGVQBYGUSU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|