C16H11N5O5 — CID 22503786
3-[(4-nitrophenyl)carbamoylamino]quinoxaline-2-carboxylic acid (PubChem CID 22503786) has the molecular formula C16H11N5O5 and a molecular weight of 353.29 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)carbamoylamino]quinoxaline-2-carboxylic acid.
| Compound Name | 3-[(4-nitrophenyl)carbamoylamino]quinoxaline-2-carboxylic acid |
|---|---|
| PubChem CID | 22503786 |
| Molecular Formula | C16H11N5O5 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-[(4-nitrophenyl)carbamoylamino]quinoxaline-2-carboxylic acid |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1nc2ccccc2nc1C(=O)O |
| InChI | InChI=1S/C16H11N5O5/c22-15(23)13-14(19-12-4-2-1-3-11(12)18-13)20-16(24)17-9-5-7-10(8-6-9)21(25)26/h1-8H,(H,22,23)(H2,17,19,20,24) |
| InChIKey | YVYOSELOCCHVAK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|