C16H18N4O3 — CID 157090092
1-(4-nitrophenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea (PubChem CID 157090092) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea.
| Compound Name | 1-(4-nitrophenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 157090092 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(4-nitrophenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea |
| SMILES | Cc1nc(NC(=O)Nc2ccc([N+](=O)[O-])cc2)c(C)c(C)c1C |
| InChI | InChI=1S/C16H18N4O3/c1-9-10(2)12(4)17-15(11(9)3)19-16(21)18-13-5-7-14(8-6-13)20(22)23/h5-8H,1-4H3,(H2,17,18,19,21) |
| InChIKey | AEOHWMBWHZEALW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|