C11H9BrN4O3S — CID 139201996
1-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-(4-nitrophenyl)urea (PubChem CID 139201996) has the molecular formula C11H9BrN4O3S and a molecular weight of 357.19 g/mol. Its IUPAC name is 1-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-(4-nitrophenyl)urea.
| Compound Name | 1-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 139201996 |
| Molecular Formula | C11H9BrN4O3S |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 1-(5-bromo-4-methyl-1,3-thiazol-2-yl)-3-(4-nitrophenyl)urea |
| SMILES | Cc1nc(NC(=O)Nc2ccc([N+](=O)[O-])cc2)sc1Br |
| InChI | InChI=1S/C11H9BrN4O3S/c1-6-9(12)20-11(13-6)15-10(17)14-7-2-4-8(5-3-7)16(18)19/h2-5H,1H3,(H2,13,14,15,17) |
| InChIKey | AXVYWJIVCIOZSZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|