C13H10N4O3S — CID 71911952
6-methyl-N-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 71911952) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is 6-methyl-N-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | 6-methyl-N-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 71911952 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 6-methyl-N-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | Cc1cn2cc(C(=O)Nc3ccc([N+](=O)[O-])cc3)sc2n1 |
| InChI | InChI=1S/C13H10N4O3S/c1-8-6-16-7-11(21-13(16)14-8)12(18)15-9-2-4-10(5-3-9)17(19)20/h2-7H,1H3,(H,15,18) |
| InChIKey | SJKGCFZHSFFKKZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|