About N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide
N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 166155502) has the molecular formula C20H16N4O3S
and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| PubChem CID | 166155502 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | Cc1cn2cc(C(=O)Nc3ccc(Oc4ccccc4C(N)=O)cc3)sc2n1 |
| InChI | InChI=1S/C20H16N4O3S/c1-12-10-24-11-17(28-20(24)22-12)19(26)23-13-6-8-14(9-7-13)27-16-5-3-2-4-15(16)18(21)25/h2-11H,1H3,(H2,21,25)(H,23,26) |
| InChIKey | DIIKYKPTASGEQB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
The IUPAC name of N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (CID 166155502) is N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
What is the SMILES notation for N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
The canonical SMILES for N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide is Cc1cn2cc(C(=O)Nc3ccc(Oc4ccccc4C(N)=O)cc3)sc2n1.
What is the InChIKey of N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
The InChIKey is DIIKYKPTASGEQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O3S/c1-12-10-24-11-17(28-20(24)22-12)19(26)23-13-6-8-14(9-7-13)27-16-5-3-2-4-15(16)18(21)25/h2-11H,1H3,(H2,21,25)(H,23,26).
What are the key properties of N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide?
N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide has a molecular weight of 392.44 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-carbamoylphenoxy)phenyl]-6-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide is sourced from PubChem (CID 166155502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).