C23H20N4O3 — CID 166155672
N-[4-(2-carbamoylphenoxy)phenyl]-2,3-dimethylbenzimidazole-5-carboxamide (PubChem CID 166155672) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)phenyl]-2,3-dimethylbenzimidazole-5-carboxamide.
| Compound Name | N-[4-(2-carbamoylphenoxy)phenyl]-2,3-dimethylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 166155672 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)phenyl]-2,3-dimethylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3ccc(Oc4ccccc4C(N)=O)cc3)cc2n1C |
| InChI | InChI=1S/C23H20N4O3/c1-14-25-19-12-7-15(13-20(19)27(14)2)23(29)26-16-8-10-17(11-9-16)30-21-6-4-3-5-18(21)22(24)28/h3-13H,1-2H3,(H2,24,28)(H,26,29) |
| InChIKey | OZTNOMYPJMPTSS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |