C15H8ClN5O3S2 — CID 21431580
[6-chloro-2-[(4-nitrophenyl)carbamoylamino]-1,3-benzothiazol-4-yl] thiocyanate (PubChem CID 21431580) has the molecular formula C15H8ClN5O3S2 and a molecular weight of 405.85 g/mol. Its IUPAC name is [6-chloro-2-[(4-nitrophenyl)carbamoylamino]-1,3-benzothiazol-4-yl] thiocyanate.
| Compound Name | [6-chloro-2-[(4-nitrophenyl)carbamoylamino]-1,3-benzothiazol-4-yl] thiocyanate |
|---|---|
| PubChem CID | 21431580 |
| Molecular Formula | C15H8ClN5O3S2 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | [6-chloro-2-[(4-nitrophenyl)carbamoylamino]-1,3-benzothiazol-4-yl] thiocyanate |
| SMILES | N#CSc1cc(Cl)cc2sc(NC(=O)Nc3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C15H8ClN5O3S2/c16-8-5-11(25-7-17)13-12(6-8)26-15(19-13)20-14(22)18-9-1-3-10(4-2-9)21(23)24/h1-6H,(H2,18,19,20,22) |
| InChIKey | MGAJPJMKMLITEO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|