C15H7ClF2N4OS — CID 146255071
1-(3-chloro-5-cyanophenyl)-3-(4,6-difluoro-1,3-benzothiazol-2-yl)urea (PubChem CID 146255071) has the molecular formula C15H7ClF2N4OS and a molecular weight of 364.76 g/mol. Its IUPAC name is 1-(3-chloro-5-cyanophenyl)-3-(4,6-difluoro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(3-chloro-5-cyanophenyl)-3-(4,6-difluoro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 146255071 |
| Molecular Formula | C15H7ClF2N4OS |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 1-(3-chloro-5-cyanophenyl)-3-(4,6-difluoro-1,3-benzothiazol-2-yl)urea |
| SMILES | N#Cc1cc(Cl)cc(NC(=O)Nc2nc3c(F)cc(F)cc3s2)c1 |
| InChI | InChI=1S/C15H7ClF2N4OS/c16-8-1-7(6-19)2-10(3-8)20-14(23)22-15-21-13-11(18)4-9(17)5-12(13)24-15/h1-5H,(H2,20,21,22,23) |
| InChIKey | KEFZCASXCKUKHJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |