C12H13N5O3S — CID 3099816
1-(4-nitrophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 3099816) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(4-nitrophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 3099816 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-(4-nitrophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCc1nnc(NC(=O)Nc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C12H13N5O3S/c1-2-3-10-15-16-12(21-10)14-11(18)13-8-4-6-9(7-5-8)17(19)20/h4-7H,2-3H2,1H3,(H2,13,14,16,18) |
| InChIKey | HXMODSHFJMPJIQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|