C14H16N4O3S2 — CID 55360911
2-(4-nitrophenyl)sulfanyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 55360911) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 55360911 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCc1nnc(NC(=O)C(C)Sc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C14H16N4O3S2/c1-3-4-12-16-17-14(23-12)15-13(19)9(2)22-11-7-5-10(6-8-11)18(20)21/h5-9H,3-4H2,1-2H3,(H,15,17,19) |
| InChIKey | LAOGFFSWUIALSC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|