C14H14N4O3S3 — CID 40855546
(2S)-2-(4-nitrophenyl)sulfanyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 40855546) has the molecular formula C14H14N4O3S3 and a molecular weight of 382.49 g/mol. Its IUPAC name is (2S)-2-(4-nitrophenyl)sulfanyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2S)-2-(4-nitrophenyl)sulfanyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 40855546 |
| Molecular Formula | C14H14N4O3S3 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (2S)-2-(4-nitrophenyl)sulfanyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C=CCSc1nnc(NC(=O)[C@H](C)Sc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C14H14N4O3S3/c1-3-8-22-14-17-16-13(24-14)15-12(19)9(2)23-11-6-4-10(5-7-11)18(20)21/h3-7,9H,1,8H2,2H3,(H,15,16,19)/t9-/m0/s1 |
| InChIKey | OOXXCRNFHIXWCM-VIFPVBQESA-N |
| XLogP | 3.84 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|