C15H17N3OS2 — CID 8003941
(3R)-3-phenyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 8003941) has the molecular formula C15H17N3OS2 and a molecular weight of 319.46 g/mol. Its IUPAC name is (3R)-3-phenyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (3R)-3-phenyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 8003941 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (3R)-3-phenyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | C=CCSc1nnc(NC(=O)C[C@@H](C)c2ccccc2)s1 |
| InChI | InChI=1S/C15H17N3OS2/c1-3-9-20-15-18-17-14(21-15)16-13(19)10-11(2)12-7-5-4-6-8-12/h3-8,11H,1,9-10H2,2H3,(H,16,17,19)/t11-/m1/s1 |
| InChIKey | BQPNASOYDCOOAR-LLVKDONJSA-N |
| XLogP | 3.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|