C13H12ClN3OS2 — CID 8697316
2-(2-chlorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 8697316) has the molecular formula C13H12ClN3OS2 and a molecular weight of 325.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8697316 |
| Molecular Formula | C13H12ClN3OS2 |
| Molecular Weight | 325.85 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C13H12ClN3OS2/c1-2-7-19-13-17-16-12(20-13)15-11(18)8-9-5-3-4-6-10(9)14/h2-6H,1,7-8H2,(H,15,16,18) |
| InChIKey | QSFOMDUNKCTFFF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|