C13H8F5N3OS2 — CID 24555010
2-(2,3,4,5,6-pentafluorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 24555010) has the molecular formula C13H8F5N3OS2 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24555010 |
| Molecular Formula | C13H8F5N3OS2 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)Cc2c(F)c(F)c(F)c(F)c2F)s1 |
| InChI | InChI=1S/C13H8F5N3OS2/c1-2-3-23-13-21-20-12(24-13)19-6(22)4-5-7(14)9(16)11(18)10(17)8(5)15/h2H,1,3-4H2,(H,19,20,22) |
| InChIKey | BFEWKAQKQDKMTD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|