C12H15F2N3OS2 — CID 167864114
4,4-difluoro-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 167864114) has the molecular formula C12H15F2N3OS2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4,4-difluoro-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167864114 |
| Molecular Formula | C12H15F2N3OS2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4,4-difluoro-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)C2CCC(F)(F)CC2)s1 |
| InChI | InChI=1S/C12H15F2N3OS2/c1-2-7-19-11-17-16-10(20-11)15-9(18)8-3-5-12(13,14)6-4-8/h2,8H,1,3-7H2,(H,15,16,18) |
| InChIKey | QDUQDSVALXUYJT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|