C12H17N3OS2 — CID 167808635
2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclobutane-1-carboxamide (PubChem CID 167808635) has the molecular formula C12H17N3OS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclobutane-1-carboxamide.
| Compound Name | 2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167808635 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclobutane-1-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)C2CCC2(C)C)s1 |
| InChI | InChI=1S/C12H17N3OS2/c1-4-7-17-11-15-14-10(18-11)13-9(16)8-5-6-12(8,2)3/h4,8H,1,5-7H2,2-3H3,(H,13,14,16) |
| InChIKey | VLZJSOIYLGBOLA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|