C13H15Cl2N3OS2 — CID 2143414
trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide (PubChem CID 2143414) has the molecular formula C13H15Cl2N3OS2 and a molecular weight of 364.32 g/mol. Its IUPAC name is trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2143414 |
| Molecular Formula | C13H15Cl2N3OS2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)[C@@H]2[C@H](C=C(Cl)Cl)C2(C)C)s1 |
| InChI | InChI=1S/C13H15Cl2N3OS2/c1-4-5-20-12-18-17-11(21-12)16-10(19)9-7(6-8(14)15)13(9,2)3/h4,6-7,9H,1,5H2,2-3H3,(H,16,17,19)/t7-,9-/m0/s1 |
| InChIKey | QTXOTKKPKPOXMQ-CBAPKCEASA-N |
| XLogP | 4.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|