C10H13N3OS2 — CID 41411722
cis-(1S,2R)-2-methyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide (PubChem CID 41411722) has the molecular formula C10H13N3OS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is cis-(1S,2R)-2-methyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-methyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 41411722 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | cis-(1S,2R)-2-methyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)cyclopropane-1-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)[C@H]2C[C@H]2C)s1 |
| InChI | InChI=1S/C10H13N3OS2/c1-3-4-15-10-13-12-9(16-10)11-8(14)7-5-6(7)2/h3,6-7H,1,4-5H2,2H3,(H,11,12,14)/t6-,7+/m1/s1 |
| InChIKey | HUMFRLBWOQWAKF-RQJHMYQMSA-N |
| XLogP | 2.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|